C7H12O4 — CID 44603818
1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-one (PubChem CID 44603818) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-one.
| Compound Name | 1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-one |
|---|---|
| PubChem CID | 44603818 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-(1,3-dioxan-2-yl)-3-hydroxypropan-2-one |
| SMILES | O=C(CO)CC1OCCCO1 |
| InChI | InChI=1S/C7H12O4/c8-5-6(9)4-7-10-2-1-3-11-7/h7-8H,1-5H2 |
| InChIKey | VREGGJCFEWBBRN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |