C32H49NO8 — CID 44604405
(4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-(methoxymethoxy)pentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 44604405) has the molecular formula C32H49NO8 and a molecular weight of 575.74 g/mol. Its IUPAC name is (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-(methoxymethoxy)pentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-(methoxymethoxy)pentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 44604405 |
| Molecular Formula | C32H49NO8 |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | (4R)-3-[(2R)-2-[(2R,5S)-5-[(2S,3S,4S)-3-hydroxy-4-[(2R,5S)-5-[(2S)-2-(methoxymethoxy)pentyl]oxolan-2-yl]pentan-2-yl]oxolan-2-yl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@@H](C[C@@H]1CC[C@H]([C@@H](C)[C@H](O)[C@H](C)[C@@H]2CC[C@H]([C@@H](C)C(=O)N3C(=O)OC[C@H]3c3ccccc3)O2)O1)OCOC |
| InChI | InChI=1S/C32H49NO8/c1-6-10-24(39-19-37-5)17-25-13-14-27(40-25)20(2)30(34)21(3)28-15-16-29(41-28)22(4)31(35)33-26(18-38-32(33)36)23-11-8-7-9-12-23/h7-9,11-12,20-22,24-30,34H,6,10,13-19H2,1-5H3/t20-,21-,22-,24+,25+,26+,27-,28+,29-,30+/m1/s1 |
| InChIKey | UHSUOJBIAHJSMW-XADDZFAWSA-N |
| XLogP | 5.25 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|