C28H34O2 — CID 44606274
(1R,5R,7R)-1-(2,2-diphenylethenyl)-7-heptyl-3-oxabicyclo[3.2.1]octan-8-one (PubChem CID 44606274) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (1R,5R,7R)-1-(2,2-diphenylethenyl)-7-heptyl-3-oxabicyclo[3.2.1]octan-8-one.
| Compound Name | (1R,5R,7R)-1-(2,2-diphenylethenyl)-7-heptyl-3-oxabicyclo[3.2.1]octan-8-one |
|---|---|
| PubChem CID | 44606274 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (1R,5R,7R)-1-(2,2-diphenylethenyl)-7-heptyl-3-oxabicyclo[3.2.1]octan-8-one |
| SMILES | CCCCCCC[C@@H]1C[C@@H]2COC[C@@]1(C=C(c1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C28H34O2/c1-2-3-4-5-12-17-25-18-24-20-30-21-28(25,27(24)29)19-26(22-13-8-6-9-14-22)23-15-10-7-11-16-23/h6-11,13-16,19,24-25H,2-5,12,17-18,20-21H2,1H3/t24-,25-,28-/m1/s1 |
| InChIKey | HHZMKWPEUPBAHB-INNMJMHTSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|