C23H30O2 — CID 44607282
(E,2R,3S)-7-methyl-10-phenyl-2-(1-prop-1-en-2-ylcyclopropyl)dec-7-en-4-yne-2,3-diol (PubChem CID 44607282) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is (E,2R,3S)-7-methyl-10-phenyl-2-(1-prop-1-en-2-ylcyclopropyl)dec-7-en-4-yne-2,3-diol.
| Compound Name | (E,2R,3S)-7-methyl-10-phenyl-2-(1-prop-1-en-2-ylcyclopropyl)dec-7-en-4-yne-2,3-diol |
|---|---|
| PubChem CID | 44607282 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (E,2R,3S)-7-methyl-10-phenyl-2-(1-prop-1-en-2-ylcyclopropyl)dec-7-en-4-yne-2,3-diol |
| SMILES | C=C(C)C1([C@@](C)(O)[C@@H](O)C#CC/C(C)=C/CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30O2/c1-18(2)23(16-17-23)22(4,25)21(24)15-9-11-19(3)10-8-14-20-12-6-5-7-13-20/h5-7,10,12-13,21,24-25H,1,8,11,14,16-17H2,2-4H3/b19-10+/t21-,22-/m0/s1 |
| InChIKey | DAKAPNJXYUXWOH-LTNQGDBYSA-N |
| XLogP | 4.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|