C22H31N5O5 — CID 44608007
4-[[4-[(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoyl]-3-methylbutyl]triazol-1-yl]methyl]benzoic acid (PubChem CID 44608007) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[4-[(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoyl]-3-methylbutyl]triazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoyl]-3-methylbutyl]triazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 44608007 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-[[4-[(2S)-2-[[(1S)-5-amino-1-carboxypentyl]carbamoyl]-3-methylbutyl]triazol-1-yl]methyl]benzoic acid |
| SMILES | CC(C)[C@H](Cc1cn(Cc2ccc(C(=O)O)cc2)nn1)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C22H31N5O5/c1-14(2)18(20(28)24-19(22(31)32)5-3-4-10-23)11-17-13-27(26-25-17)12-15-6-8-16(9-7-15)21(29)30/h6-9,13-14,18-19H,3-5,10-12,23H2,1-2H3,(H,24,28)(H,29,30)(H,31,32)/t18-,19-/m0/s1 |
| InChIKey | ZFYKXBBWZOQIRM-OALUTQOASA-N |
| XLogP | 1.54 |
| TPSA | 160.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|