C16H10Br2O3 — CID 44610966
2-(3,4-dibromophenyl)-2H-chromene-3-carboxylic acid (PubChem CID 44610966) has the molecular formula C16H10Br2O3 and a molecular weight of 410.06 g/mol. Its IUPAC name is 2-(3,4-dibromophenyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 2-(3,4-dibromophenyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 44610966 |
| Molecular Formula | C16H10Br2O3 |
| Molecular Weight | 410.06 g/mol |
| Exact Mass | 407.90 |
| IUPAC Name | 2-(3,4-dibromophenyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccccc2OC1c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C16H10Br2O3/c17-12-6-5-10(8-13(12)18)15-11(16(19)20)7-9-3-1-2-4-14(9)21-15/h1-8,15H,(H,19,20) |
| InChIKey | PYQHJKYOZYUSGC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |