C12H20N2OS — CID 44612794
2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-propan-2-yl-1,3-thiazolidin-4-one (PubChem CID 44612794) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-propan-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-propan-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 44612794 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-propan-2-yl-1,3-thiazolidin-4-one |
| SMILES | CC(C)N1C(=O)CSC1C1=CCCN(C)C1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(2)14-11(15)8-16-12(14)10-5-4-6-13(3)7-10/h5,9,12H,4,6-8H2,1-3H3 |
| InChIKey | LZFMBQWMZANYOC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|