C38H34F6N8O6 — CID 44613806
2-nitro-N-[3-[4-[3-[[2-nitro-7-(trifluoromethoxy)acridin-9-yl]amino]propyl]piperazin-1-yl]propyl]-7-(trifluoromethoxy)acridin-9-amine (PubChem CID 44613806) has the molecular formula C38H34F6N8O6 and a molecular weight of 812.73 g/mol. Its IUPAC name is 2-nitro-N-[3-[4-[3-[[2-nitro-7-(trifluoromethoxy)acridin-9-yl]amino]propyl]piperazin-1-yl]propyl]-7-(trifluoromethoxy)acridin-9-amine.
| Compound Name | 2-nitro-N-[3-[4-[3-[[2-nitro-7-(trifluoromethoxy)acridin-9-yl]amino]propyl]piperazin-1-yl]propyl]-7-(trifluoromethoxy)acridin-9-amine |
|---|---|
| PubChem CID | 44613806 |
| Molecular Formula | C38H34F6N8O6 |
| Molecular Weight | 812.73 g/mol |
| Exact Mass | 812.25 |
| IUPAC Name | 2-nitro-N-[3-[4-[3-[[2-nitro-7-(trifluoromethoxy)acridin-9-yl]amino]propyl]piperazin-1-yl]propyl]-7-(trifluoromethoxy)acridin-9-amine |
| SMILES | O=[N+]([O-])c1ccc2nc3ccc(OC(F)(F)F)cc3c(NCCCN3CCN(CCCNc4c5cc(OC(F)(F)F)ccc5nc5ccc([N+](=O)[O-])cc45)CC3)c2c1 |
| InChI | InChI=1S/C38H34F6N8O6/c39-37(40,41)57-25-5-9-33-29(21-25)35(27-19-23(51(53)54)3-7-31(27)47-33)45-11-1-13-49-15-17-50(18-16-49)14-2-12-46-36-28-20-24(52(55)56)4-8-32(28)48-34-10-6-26(22-30(34)36)58-38(42,43)44/h3-10,19-22H,1-2,11-18H2,(H,45,47)(H,46,48) |
| InChIKey | WDXKRHZQGPBAGB-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.73 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|