C16H12N4 — CID 44614418
2-phenyl-3-(1,2,4-triazol-1-yl)-1H-indole (PubChem CID 44614418) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-phenyl-3-(1,2,4-triazol-1-yl)-1H-indole.
| Compound Name | 2-phenyl-3-(1,2,4-triazol-1-yl)-1H-indole |
|---|---|
| PubChem CID | 44614418 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-phenyl-3-(1,2,4-triazol-1-yl)-1H-indole |
| SMILES | c1ccc(-c2[nH]c3ccccc3c2-n2cncn2)cc1 |
| InChI | InChI=1S/C16H12N4/c1-2-6-12(7-3-1)15-16(20-11-17-10-18-20)13-8-4-5-9-14(13)19-15/h1-11,19H |
| InChIKey | PTKHIVVGXNYJFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |