C24H20FN3O3 — CID 44623933
ethyl 1-[[4-(4-ethenylpyrazol-1-yl)phenyl]methyl]-5-fluoro-4-oxoquinoline-3-carboxylate (PubChem CID 44623933) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl 1-[[4-(4-ethenylpyrazol-1-yl)phenyl]methyl]-5-fluoro-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[[4-(4-ethenylpyrazol-1-yl)phenyl]methyl]-5-fluoro-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 44623933 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | ethyl 1-[[4-(4-ethenylpyrazol-1-yl)phenyl]methyl]-5-fluoro-4-oxoquinoline-3-carboxylate |
| SMILES | C=Cc1cnn(-c2ccc(Cn3cc(C(=O)OCC)c(=O)c4c(F)cccc43)cc2)c1 |
| InChI | InChI=1S/C24H20FN3O3/c1-3-16-12-26-28(14-16)18-10-8-17(9-11-18)13-27-15-19(24(30)31-4-2)23(29)22-20(25)6-5-7-21(22)27/h3,5-12,14-15H,1,4,13H2,2H3 |
| InChIKey | DFPGYWMGYZEEDF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |