C31H30FNO3 — CID 44623963
N-[2-(2-fluorophenyl)ethyl]-5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)benzamide (PubChem CID 44623963) has the molecular formula C31H30FNO3 and a molecular weight of 483.58 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 44623963 |
| Molecular Formula | C31H30FNO3 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)benzamide |
| SMILES | COc1ccc(-c2ccc(OCCc3ccccc3)c(C(=O)NCCc3ccccc3F)c2)c(C)c1 |
| InChI | InChI=1S/C31H30FNO3/c1-22-20-26(35-2)13-14-27(22)25-12-15-30(36-19-17-23-8-4-3-5-9-23)28(21-25)31(34)33-18-16-24-10-6-7-11-29(24)32/h3-15,20-21H,16-19H2,1-2H3,(H,33,34) |
| InChIKey | USBHVOINGOBXGQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |