C28H31NO4 — CID 67504979
[5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)phenyl] N-cyclopentylcarbamate (PubChem CID 67504979) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is [5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)phenyl] N-cyclopentylcarbamate.
| Compound Name | [5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)phenyl] N-cyclopentylcarbamate |
|---|---|
| PubChem CID | 67504979 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [5-(4-methoxy-2-methylphenyl)-2-(2-phenylethoxy)phenyl] N-cyclopentylcarbamate |
| SMILES | COc1ccc(-c2ccc(OCCc3ccccc3)c(OC(=O)NC3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C28H31NO4/c1-20-18-24(31-2)13-14-25(20)22-12-15-26(32-17-16-21-8-4-3-5-9-21)27(19-22)33-28(30)29-23-10-6-7-11-23/h3-5,8-9,12-15,18-19,23H,6-7,10-11,16-17H2,1-2H3,(H,29,30) |
| InChIKey | OALHCECOORZBJP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |