About (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid
(2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid (PubChem CID 44624198) has the molecular formula C15H17NO6S
and a molecular weight of 339.37 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid |
| PubChem CID | 44624198 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3.C7H8O3S/c9-7(8(11)12)5-1-3-6(10)4-2-5;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,7,10H,9H2,(H,11,12);2-5H,1H3,(H,8,9,10)/t7-;/m1./s1 |
| InChIKey | KSOALHCSUNWHRL-OGFXRTJISA-N |
| XLogP | 1.72 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid?
The IUPAC name of (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid (CID 44624198) is (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid.
What is the SMILES notation for (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid?
The canonical SMILES for (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.N[C@@H](C(=O)O)c1ccc(O)cc1.
What is the InChIKey of (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid?
The InChIKey is KSOALHCSUNWHRL-OGFXRTJISA-N. The full InChI is InChI=1S/C8H9NO3.C7H8O3S/c9-7(8(11)12)5-1-3-6(10)4-2-5;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,7,10H,9H2,(H,11,12);2-5H,1H3,(H,8,9,10)/t7-;/m1./s1.
What are the key properties of (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid?
(2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid has a molecular weight of 339.37 g/mol, XLogP of 1.72, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid is sourced from PubChem (CID 44624198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).