C15H17NO6S — CID 44624198
(2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid (PubChem CID 44624198) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid.
| Compound Name | (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 44624198 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (2R)-2-amino-2-(4-hydroxyphenyl)acetic acid;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N[C@@H](C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H9NO3.C7H8O3S/c9-7(8(11)12)5-1-3-6(10)4-2-5;1-6-2-4-7(5-3-6)11(8,9)10/h1-4,7,10H,9H2,(H,11,12);2-5H,1H3,(H,8,9,10)/t7-;/m1./s1 |
| InChIKey | KSOALHCSUNWHRL-OGFXRTJISA-N |
| XLogP | 1.72 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|