C44H60IN5O4 — CID 44624845
1-methyl-2-N,4-N-bis[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]-2-N,4-N-bis(3-phenylpropyl)pyridin-1-ium-2,4-dicarboxamide iodide (PubChem CID 44624845) has the molecular formula C44H60IN5O4 and a molecular weight of 849.90 g/mol. Its IUPAC name is 1-methyl-2-N,4-N-bis[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]-2-N,4-N-bis(3-phenylpropyl)pyridin-1-ium-2,4-dicarboxamide iodide.
| Compound Name | 1-methyl-2-N,4-N-bis[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]-2-N,4-N-bis(3-phenylpropyl)pyridin-1-ium-2,4-dicarboxamide iodide |
|---|---|
| PubChem CID | 44624845 |
| Molecular Formula | C44H60IN5O4 |
| Molecular Weight | 849.90 g/mol |
| Exact Mass | 849.37 |
| IUPAC Name | 1-methyl-2-N,4-N-bis[(2S)-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl]-2-N,4-N-bis(3-phenylpropyl)pyridin-1-ium-2,4-dicarboxamide iodide |
| SMILES | CC(C)[C@@H](C(=O)N1CCCC1)N(CCCc1ccccc1)C(=O)c1cc[n+](C)c(C(=O)N(CCCc2ccccc2)[C@H](C(=O)N2CCCC2)C(C)C)c1.[I-] |
| InChI | InChI=1S/C44H60N5O4.HI/c1-33(2)39(43(52)46-25-12-13-26-46)48(29-16-22-35-18-8-6-9-19-35)41(50)37-24-31-45(5)38(32-37)42(51)49(30-17-23-36-20-10-7-11-21-36)40(34(3)4)44(53)47-27-14-15-28-47;/h6-11,18-21,24,31-34,39-40H,12-17,22-23,25-30H2,1-5H3;1H/q+1;/p-1/t39-,40-;/m0./s1 |
| InChIKey | GEUZXVYYYKZJRR-OFUZFLEOSA-M |
| XLogP | 2.96 |
| TPSA | 85.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|