C28H31NO2 — CID 142053395
N-[(5Z)-7-hydroxyocta-5,7-dien-2-yl]-N-(3-phenylpropyl)naphthalene-2-carboxamide (PubChem CID 142053395) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[(5Z)-7-hydroxyocta-5,7-dien-2-yl]-N-(3-phenylpropyl)naphthalene-2-carboxamide.
| Compound Name | N-[(5Z)-7-hydroxyocta-5,7-dien-2-yl]-N-(3-phenylpropyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 142053395 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[(5Z)-7-hydroxyocta-5,7-dien-2-yl]-N-(3-phenylpropyl)naphthalene-2-carboxamide |
| SMILES | C=C(O)/C=C\CCC(C)N(CCCc1ccccc1)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H31NO2/c1-22(11-6-7-12-23(2)30)29(20-10-15-24-13-4-3-5-14-24)28(31)27-19-18-25-16-8-9-17-26(25)21-27/h3-5,7-9,12-14,16-19,21-22,30H,2,6,10-11,15,20H2,1H3/b12-7- |
| InChIKey | JHUJGWWYRLZZMR-GHXNOFRVSA-N |
| XLogP | 6.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|