C5H12N3O3S+ — CID 44629632
[(1S)-1-carboxy-2-(4-hydroxy-1,2,5-thiadiazolidin-3-yl)ethyl]azanium (PubChem CID 44629632) has the molecular formula C5H12N3O3S+ and a molecular weight of 194.24 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(4-hydroxy-1,2,5-thiadiazolidin-3-yl)ethyl]azanium.
| Compound Name | [(1S)-1-carboxy-2-(4-hydroxy-1,2,5-thiadiazolidin-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 44629632 |
| Molecular Formula | C5H12N3O3S+ |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | [(1S)-1-carboxy-2-(4-hydroxy-1,2,5-thiadiazolidin-3-yl)ethyl]azanium |
| SMILES | [NH3+][C@@H](CC1NSNC1O)C(=O)O |
| InChI | InChI=1S/C5H11N3O3S/c6-2(5(10)11)1-3-4(9)8-12-7-3/h2-4,7-9H,1,6H2,(H,10,11)/p+1/t2-,3?,4?/m0/s1 |
| InChIKey | LZBRTXVBFVAEPN-WXJVFSNFSA-O |
| XLogP | -2.49 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|