About methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate
methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate (PubChem CID 44630672) has the molecular formula C7H7N5O2
and a molecular weight of 193.17 g/mol. Its IUPAC name is methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate.
Analyze methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate?
The IUPAC name of methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate (CID 44630672) is methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate.
What is the SMILES notation for methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate?
The canonical SMILES for methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate is COC(=O)c1cnn2c(N)cnc2n1.
What is the InChIKey of methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate?
The InChIKey is QNQXYPJNKBCLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O2/c1-14-6(13)4-2-10-12-5(8)3-9-7(12)11-4/h2-3H,8H2,1H3.
What are the key properties of methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate?
methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate has a molecular weight of 193.17 g/mol, XLogP of -0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-aminoimidazo[1,2-b][1,2,4]triazine-3-carboxylate is sourced from PubChem (CID 44630672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).