C5H8NS- — CID 44631406
1-methyl-2,3-dihydropyrrole-5-thiolate (PubChem CID 44631406) has the molecular formula C5H8NS- and a molecular weight of 114.19 g/mol. Its IUPAC name is 1-methyl-2,3-dihydropyrrole-5-thiolate.
| Compound Name | 1-methyl-2,3-dihydropyrrole-5-thiolate |
|---|---|
| PubChem CID | 44631406 |
| Molecular Formula | C5H8NS- |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 1-methyl-2,3-dihydropyrrole-5-thiolate |
| SMILES | CN1CCC=C1[S-] |
| InChI | InChI=1S/C5H9NS/c1-6-4-2-3-5(6)7/h3,7H,2,4H2,1H3/p-1 |
| InChIKey | DCHKJXDISOGKIC-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|