C23H28N2O2 — CID 44632026
ethyl 4-[5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazol-1-yl]benzoate (PubChem CID 44632026) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 44632026 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl 4-[5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2nccc2/C=C/C2C(C)=CCCC2(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-5-27-22(26)18-8-10-19(11-9-18)25-20(14-16-24-25)12-13-21-17(2)7-6-15-23(21,3)4/h7-14,16,21H,5-6,15H2,1-4H3/b13-12+ |
| InChIKey | ITGDPDKGEZBDFH-OUKQBFOZSA-N |
| XLogP | 5.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|