C28H30O2 — CID 57153942
ethyl 4-[4-[6,6-dimethyl-2-(4-methylphenyl)cyclohex-2-en-1-yl]but-3-en-1-ynyl]benzoate (PubChem CID 57153942) has the molecular formula C28H30O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 4-[4-[6,6-dimethyl-2-(4-methylphenyl)cyclohex-2-en-1-yl]but-3-en-1-ynyl]benzoate.
| Compound Name | ethyl 4-[4-[6,6-dimethyl-2-(4-methylphenyl)cyclohex-2-en-1-yl]but-3-en-1-ynyl]benzoate |
|---|---|
| PubChem CID | 57153942 |
| Molecular Formula | C28H30O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | ethyl 4-[4-[6,6-dimethyl-2-(4-methylphenyl)cyclohex-2-en-1-yl]but-3-en-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC=CC2C(c3ccc(C)cc3)=CCCC2(C)C)cc1 |
| InChI | InChI=1S/C28H30O2/c1-5-30-27(29)24-18-14-22(15-19-24)9-6-7-11-26-25(10-8-20-28(26,3)4)23-16-12-21(2)13-17-23/h7,10-19,26H,5,8,20H2,1-4H3 |
| InChIKey | QUTIIAGFSWMWBT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|