C20H22O3 — CID 54335575
ethyl 4-[4-(6-hydroxy-2-methylcyclohexen-1-yl)but-3-en-1-ynyl]benzoate (PubChem CID 54335575) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl 4-[4-(6-hydroxy-2-methylcyclohexen-1-yl)but-3-en-1-ynyl]benzoate.
| Compound Name | ethyl 4-[4-(6-hydroxy-2-methylcyclohexen-1-yl)but-3-en-1-ynyl]benzoate |
|---|---|
| PubChem CID | 54335575 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethyl 4-[4-(6-hydroxy-2-methylcyclohexen-1-yl)but-3-en-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC=CC2=C(C)CCCC2O)cc1 |
| InChI | InChI=1S/C20H22O3/c1-3-23-20(22)17-13-11-16(12-14-17)8-4-5-9-18-15(2)7-6-10-19(18)21/h5,9,11-14,19,21H,3,6-7,10H2,1-2H3 |
| InChIKey | TVFXFKRPDBFKQT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|