C31H34O2 — CID 101098793
ethyl 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate (PubChem CID 101098793) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is ethyl 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate.
| Compound Name | ethyl 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate |
|---|---|
| PubChem CID | 101098793 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl 4-[(E)-4-[6-(4-tert-butylphenyl)-3,3-dimethylcyclohexa-1,5-dien-1-yl]but-3-en-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#C/C=C/C2=CC(C)(C)CC=C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H34O2/c1-7-33-29(32)25-14-12-23(13-15-25)10-8-9-11-26-22-31(5,6)21-20-28(26)24-16-18-27(19-17-24)30(2,3)4/h9,11-20,22H,7,21H2,1-6H3/b11-9+ |
| InChIKey | SGRCMVMJJCCLAI-PKNBQFBNSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|