C19H25N3O6S — CID 44635033
2-[[2-[bis(prop-2-enyl)amino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid (PubChem CID 44635033) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[[2-[bis(prop-2-enyl)amino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid.
| Compound Name | 2-[[2-[bis(prop-2-enyl)amino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 44635033 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[[2-[bis(prop-2-enyl)amino]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide;oxalic acid |
| SMILES | C=CCN(CC=C)CC(=O)Nc1sc2c(c1C(N)=O)CCCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H23N3O2S.C2H2O4/c1-3-9-20(10-4-2)11-14(21)19-17-15(16(18)22)12-7-5-6-8-13(12)23-17;3-1(4)2(5)6/h3-4H,1-2,5-11H2,(H2,18,22)(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | XQUUYFLYTXCBKI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|