C21H23ClN2O — CID 44654830
1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-yl(phenyl)methanol chloride (PubChem CID 44654830) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-yl(phenyl)methanol chloride.
| Compound Name | 1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-yl(phenyl)methanol chloride |
|---|---|
| PubChem CID | 44654830 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-12-yl(phenyl)methanol chloride |
| SMILES | OC(c1ccccc1)c1ccc2c(c1)c1c3n2CC[NH2+]C3CCC1.[Cl-] |
| InChI | InChI=1S/C21H22N2O.ClH/c24-21(14-5-2-1-3-6-14)15-9-10-19-17(13-15)16-7-4-8-18-20(16)23(19)12-11-22-18;/h1-3,5-6,9-10,13,18,21-22,24H,4,7-8,11-12H2;1H |
| InChIKey | UIMYLKVQGQYBPZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 41.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|