C19H22ClN3O2 — CID 44655688
1-(4-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanol chloride (PubChem CID 44655688) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanol chloride.
| Compound Name | 1-(4-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanol chloride |
|---|---|
| PubChem CID | 44655688 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanol chloride |
| SMILES | COc1ccc(C(O)Cn2c3[n+](c4ccccc42)CCCN3)cc1.[Cl-] |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-24-15-9-7-14(8-10-15)18(23)13-22-17-6-3-2-5-16(17)21-12-4-11-20-19(21)22;/h2-3,5-10,18,23H,4,11-13H2,1H3;1H |
| InChIKey | XPKKBKZWVLOBKO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 50.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|