C21H32INO4 — CID 44655948
3-[5-(butoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium iodide (PubChem CID 44655948) has the molecular formula C21H32INO4 and a molecular weight of 489.39 g/mol. Its IUPAC name is 3-[5-(butoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium iodide.
| Compound Name | 3-[5-(butoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 44655948 |
| Molecular Formula | C21H32INO4 |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 3-[5-(butoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium iodide |
| SMILES | CCCCOCc1ccc2oc(C(=O)OC(C)CC[N+](C)(C)C)cc2c1.[I-] |
| InChI | InChI=1S/C21H32NO4.HI/c1-6-7-12-24-15-17-8-9-19-18(13-17)14-20(26-19)21(23)25-16(2)10-11-22(3,4)5;/h8-9,13-14,16H,6-7,10-12,15H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | ROFWOKJOFJDXJE-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|