C18H25NO4 — CID 3145406
2-(diethylamino)ethyl 5-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 3145406) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 5-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | 2-(diethylamino)ethyl 5-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 3145406 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-(diethylamino)ethyl 5-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1ccc2oc(C(=O)OCCN(CC)CC)cc2c1 |
| InChI | InChI=1S/C18H25NO4/c1-4-19(5-2)9-10-22-18(20)17-12-15-11-14(13-21-6-3)7-8-16(15)23-17/h7-8,11-12H,4-6,9-10,13H2,1-3H3 |
| InChIKey | WBTKBNQZRCBGPI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |