C19H28NO4+ — CID 3756799
3-[5-(ethoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium (PubChem CID 3756799) has the molecular formula C19H28NO4+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 3-[5-(ethoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium.
| Compound Name | 3-[5-(ethoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium |
|---|---|
| PubChem CID | 3756799 |
| Molecular Formula | C19H28NO4+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 3-[5-(ethoxymethyl)-1-benzofuran-2-carbonyl]oxybutyl-trimethylazanium |
| SMILES | CCOCc1ccc2oc(C(=O)OC(C)CC[N+](C)(C)C)cc2c1 |
| InChI | InChI=1S/C19H28NO4/c1-6-22-13-15-7-8-17-16(11-15)12-18(24-17)19(21)23-14(2)9-10-20(3,4)5/h7-8,11-12,14H,6,9-10,13H2,1-5H3/q+1 |
| InChIKey | CDVWYKIUVSUIMU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|