C22H22BrN3O2 — CID 44656035
2-[2-(3-hydroxypropylamino)-3H-benzimidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide (PubChem CID 44656035) has the molecular formula C22H22BrN3O2 and a molecular weight of 440.34 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropylamino)-3H-benzimidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide.
| Compound Name | 2-[2-(3-hydroxypropylamino)-3H-benzimidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
|---|---|
| PubChem CID | 44656035 |
| Molecular Formula | C22H22BrN3O2 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[2-(3-hydroxypropylamino)-3H-benzimidazol-1-ium-1-yl]-1-naphthalen-1-ylethanone bromide |
| SMILES | O=C(C[n+]1c(NCCCO)[nH]c2ccccc21)c1cccc2ccccc12.[Br-] |
| InChI | InChI=1S/C22H21N3O2.BrH/c26-14-6-13-23-22-24-19-11-3-4-12-20(19)25(22)15-21(27)18-10-5-8-16-7-1-2-9-17(16)18;/h1-5,7-12,26H,6,13-15H2,(H,23,24);1H |
| InChIKey | CMURXWIAEYHKLY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|