C24H34N2O6 — CID 44657047
(2-hydroxyphenyl)methyl-[6-[(2-hydroxyphenyl)methyl-methylazaniumyl]hexyl]-methylazanium;oxalate (PubChem CID 44657047) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2-hydroxyphenyl)methyl-[6-[(2-hydroxyphenyl)methyl-methylazaniumyl]hexyl]-methylazanium;oxalate.
| Compound Name | (2-hydroxyphenyl)methyl-[6-[(2-hydroxyphenyl)methyl-methylazaniumyl]hexyl]-methylazanium;oxalate |
|---|---|
| PubChem CID | 44657047 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2-hydroxyphenyl)methyl-[6-[(2-hydroxyphenyl)methyl-methylazaniumyl]hexyl]-methylazanium;oxalate |
| SMILES | C[NH+](CCCCCC[NH+](C)Cc1ccccc1O)Cc1ccccc1O.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/C22H32N2O2.C2H2O4/c1-23(17-19-11-5-7-13-21(19)25)15-9-3-4-10-16-24(2)18-20-12-6-8-14-22(20)26;3-1(4)2(5)6/h5-8,11-14,25-26H,3-4,9-10,15-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WUFXRAKLHMSGDO-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|