C23H25N3O5 — CID 44658355
(Z)-[1-[2-(diethylazaniumyl)ethyl]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-phenylmethanolate (PubChem CID 44658355) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is (Z)-[1-[2-(diethylazaniumyl)ethyl]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-phenylmethanolate.
| Compound Name | (Z)-[1-[2-(diethylazaniumyl)ethyl]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-phenylmethanolate |
|---|---|
| PubChem CID | 44658355 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (Z)-[1-[2-(diethylazaniumyl)ethyl]-2-(2-nitrophenyl)-4,5-dioxopyrrolidin-3-ylidene]-phenylmethanolate |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)/C(=C(\[O-])c2ccccc2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25N3O5/c1-3-24(4-2)14-15-25-20(17-12-8-9-13-18(17)26(30)31)19(22(28)23(25)29)21(27)16-10-6-5-7-11-16/h5-13,20,27H,3-4,14-15H2,1-2H3/b21-19- |
| InChIKey | HUCQFNJLMPYIQD-VZCXRCSSSA-N |
| XLogP | 0.74 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|