C11H12ClN3O3 — CID 44658898
3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride (PubChem CID 44658898) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride.
| Compound Name | 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride |
|---|---|
| PubChem CID | 44658898 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride |
| SMILES | O=C(O)C(CO)Nc1[nH+]cnc2ccccc12.[Cl-] |
| InChI | InChI=1S/C11H11N3O3.ClH/c15-5-9(11(16)17)14-10-7-3-1-2-4-8(7)12-6-13-10;/h1-4,6,9,15H,5H2,(H,16,17)(H,12,13,14);1H |
| InChIKey | MOXWZYFMQXUVMA-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |