3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride

C11H12ClN3O3 — CID 44658898

IUPAC3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride
SMILESO=C(O)C(CO)Nc1[nH+]cnc2ccccc12.[Cl-]
InChIInChI=1S/C11H11N3O3.ClH/c15-5-9(11(16)17)14-10-7-3-1-2-4-8(7)12-6-13-10;/h1-4,6,9,15H,5H2,(H,16,17)(H,12,13,14);1H
InChIKeyMOXWZYFMQXUVMA-UHFFFAOYSA-N
MW269.69 g/mol
LogP-3.09
Rot. Bonds4

About 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride

3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride (PubChem CID 44658898) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride.

Molecular Properties

Compound Name3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride
PubChem CID44658898
Molecular FormulaC11H12ClN3O3
Molecular Weight269.69 g/mol
Exact Mass269.06
IUPAC Name3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride
SMILESO=C(O)C(CO)Nc1[nH+]cnc2ccccc12.[Cl-]
InChIInChI=1S/C11H11N3O3.ClH/c15-5-9(11(16)17)14-10-7-3-1-2-4-8(7)12-6-13-10;/h1-4,6,9,15H,5H2,(H,16,17)(H,12,13,14);1H
InChIKeyMOXWZYFMQXUVMA-UHFFFAOYSA-N
XLogP-3.09
TPSA96.59 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.69
LogP ≤ 5-3.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride?
The IUPAC name of 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride (CID 44658898) is 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride.
What is the SMILES notation for 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride?
The canonical SMILES for 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride is O=C(O)C(CO)Nc1[nH+]cnc2ccccc12.[Cl-].
What is the InChIKey of 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride?
The InChIKey is MOXWZYFMQXUVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3.ClH/c15-5-9(11(16)17)14-10-7-3-1-2-4-8(7)12-6-13-10;/h1-4,6,9,15H,5H2,(H,16,17)(H,12,13,14);1H.
What are the key properties of 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride?
3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride has a molecular weight of 269.69 g/mol, XLogP of -3.09, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(quinazolin-3-ium-4-ylamino)propanoic acid chloride is sourced from PubChem (CID 44658898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).