C12H17NO5S — CID 44659219
2,4-dimethyl-3-(2-oxopyrrolidin-1-yl)benzenesulfonic acid;hydrate (PubChem CID 44659219) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2,4-dimethyl-3-(2-oxopyrrolidin-1-yl)benzenesulfonic acid;hydrate.
| Compound Name | 2,4-dimethyl-3-(2-oxopyrrolidin-1-yl)benzenesulfonic acid;hydrate |
|---|---|
| PubChem CID | 44659219 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2,4-dimethyl-3-(2-oxopyrrolidin-1-yl)benzenesulfonic acid;hydrate |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C)c1N1CCCC1=O.O |
| InChI | InChI=1S/C12H15NO4S.H2O/c1-8-5-6-10(18(15,16)17)9(2)12(8)13-7-3-4-11(13)14;/h5-6H,3-4,7H2,1-2H3,(H,15,16,17);1H2 |
| InChIKey | OMQLBNYXPLGBQR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|