C26H34ClF3N2O3 — CID 44660725
(3aR,5R,8aR,9aR)-8a-methyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one chloride (PubChem CID 44660725) has the molecular formula C26H34ClF3N2O3 and a molecular weight of 515.02 g/mol. Its IUPAC name is (3aR,5R,8aR,9aR)-8a-methyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one chloride.
| Compound Name | (3aR,5R,8aR,9aR)-8a-methyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one chloride |
|---|---|
| PubChem CID | 44660725 |
| Molecular Formula | C26H34ClF3N2O3 |
| Molecular Weight | 515.02 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (3aR,5R,8aR,9aR)-8a-methyl-3-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]methyl]spiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one chloride |
| SMILES | C[C@]12CCC[C@]3(CO3)C1C[C@@H]1C(C[NH+]3CCN(c4cccc(C(F)(F)F)c4)CC3)C(=O)O[C@@H]1C2.[Cl-] |
| InChI | InChI=1S/C26H33F3N2O3.ClH/c1-24-6-3-7-25(16-33-25)22(24)13-19-20(23(32)34-21(19)14-24)15-30-8-10-31(11-9-30)18-5-2-4-17(12-18)26(27,28)29;/h2,4-5,12,19-22H,3,6-11,13-16H2,1H3;1H/t19-,20?,21-,22?,24-,25+;/m1./s1 |
| InChIKey | QKXYCKPUWSLDRV-CUSGXOHKSA-N |
| XLogP | -0.06 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.02 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|