About 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride
4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride (PubChem CID 44662132) has the molecular formula C23H24ClN3O
and a molecular weight of 393.92 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride.
Molecular Properties
| Compound Name | 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride |
| PubChem CID | 44662132 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride |
| SMILES | Cc1nc([NH+]2CCC(Cc3ccccc3)CC2)c2oc3ccccc3c2n1.[Cl-] |
| InChI | InChI=1S/C23H23N3O.ClH/c1-16-24-21-19-9-5-6-10-20(19)27-22(21)23(25-16)26-13-11-18(12-14-26)15-17-7-3-2-4-8-17;/h2-10,18H,11-15H2,1H3;1H |
| InChIKey | LEWIJGCMZFAUIB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 43.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride?
The IUPAC name of 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride (CID 44662132) is 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride.
What is the SMILES notation for 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride?
The canonical SMILES for 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride is Cc1nc([NH+]2CCC(Cc3ccccc3)CC2)c2oc3ccccc3c2n1.[Cl-].
What is the InChIKey of 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride?
The InChIKey is LEWIJGCMZFAUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O.ClH/c1-16-24-21-19-9-5-6-10-20(19)27-22(21)23(25-16)26-13-11-18(12-14-26)15-17-7-3-2-4-8-17;/h2-10,18H,11-15H2,1H3;1H.
What are the key properties of 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride?
4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride has a molecular weight of 393.92 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzylpiperidin-1-ium-1-yl)-2-methyl-[1]benzofuro[3,2-d]pyrimidine chloride is sourced from PubChem (CID 44662132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).