C26H23N3O10S — CID 44662433
diethyl 5-[[(Z)-3-[3-(3,5-dinitrophenoxy)phenyl]prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 44662433) has the molecular formula C26H23N3O10S and a molecular weight of 569.55 g/mol. Its IUPAC name is diethyl 5-[[(Z)-3-[3-(3,5-dinitrophenoxy)phenyl]prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(Z)-3-[3-(3,5-dinitrophenoxy)phenyl]prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 44662433 |
| Molecular Formula | C26H23N3O10S |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | diethyl 5-[[(Z)-3-[3-(3,5-dinitrophenoxy)phenyl]prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)/C=C\c2cccc(Oc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C26H23N3O10S/c1-4-37-25(31)22-15(3)23(26(32)38-5-2)40-24(22)27-21(30)10-9-16-7-6-8-19(11-16)39-20-13-17(28(33)34)12-18(14-20)29(35)36/h6-14H,4-5H2,1-3H3,(H,27,30)/b10-9- |
| InChIKey | RYKWHWPARBRCGI-KTKRTIGZSA-N |
| XLogP | 5.67 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|