C22H26ClNO2 — CID 44665847
(1-hydroxy-2-methylpropan-2-yl)-[(2-phenylmethoxynaphthalen-1-yl)methyl]azanium chloride (PubChem CID 44665847) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is (1-hydroxy-2-methylpropan-2-yl)-[(2-phenylmethoxynaphthalen-1-yl)methyl]azanium chloride.
| Compound Name | (1-hydroxy-2-methylpropan-2-yl)-[(2-phenylmethoxynaphthalen-1-yl)methyl]azanium chloride |
|---|---|
| PubChem CID | 44665847 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (1-hydroxy-2-methylpropan-2-yl)-[(2-phenylmethoxynaphthalen-1-yl)methyl]azanium chloride |
| SMILES | CC(C)(CO)[NH2+]Cc1c(OCc2ccccc2)ccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C22H25NO2.ClH/c1-22(2,16-24)23-14-20-19-11-7-6-10-18(19)12-13-21(20)25-15-17-8-4-3-5-9-17;/h3-13,23-24H,14-16H2,1-2H3;1H |
| InChIKey | KLTLWRGFKICTCQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |