C16H19ClF3N5O4 — CID 44665853
3-methyl-4-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole chloride (PubChem CID 44665853) has the molecular formula C16H19ClF3N5O4 and a molecular weight of 437.81 g/mol. Its IUPAC name is 3-methyl-4-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole chloride.
| Compound Name | 3-methyl-4-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole chloride |
|---|---|
| PubChem CID | 44665853 |
| Molecular Formula | C16H19ClF3N5O4 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 3-methyl-4-[2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole chloride |
| SMILES | Cc1nonc1OCC[NH+]1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1.[Cl-] |
| InChI | InChI=1S/C16H18F3N5O4.ClH/c1-11-15(21-28-20-11)27-9-8-22-4-6-23(7-5-22)13-3-2-12(16(17,18)19)10-14(13)24(25)26;/h2-3,10H,4-9H2,1H3;1H |
| InChIKey | MMMGHTRLGZTTMP-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|