C15H20N5O4+ — CID 7060025
3-methyl-4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole (PubChem CID 7060025) has the molecular formula C15H20N5O4+ and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-methyl-4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole.
| Compound Name | 3-methyl-4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 7060025 |
| Molecular Formula | C15H20N5O4+ |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-methyl-4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazole |
| SMILES | Cc1nonc1OCC[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C15H19N5O4/c1-12-15(17-24-16-12)23-11-10-18-6-8-19(9-7-18)13-2-4-14(5-3-13)20(21)22/h2-5H,6-11H2,1H3/p+1 |
| InChIKey | RDGCEKNWNLUOHF-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|