C25H28N2O6 — CID 44666471
(E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-2-(3-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 44666471) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-2-(3-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-2-(3-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 44666471 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-2-(3-ethoxyphenyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CCOc1cccc(C2/C(=C(\[O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CC[NH+](C)C)c1 |
| InChI | InChI=1S/C25H28N2O6/c1-4-31-18-7-5-6-16(14-18)22-21(24(29)25(30)27(22)11-10-26(2)3)23(28)17-8-9-19-20(15-17)33-13-12-32-19/h5-9,14-15,22,28H,4,10-13H2,1-3H3/b23-21+ |
| InChIKey | XUFQRJXAHGUNKV-XTQSDGFTSA-N |
| XLogP | 0.22 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|