C22H23N3O5 — CID 4921335
2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-pyridin-2-ylpyrrolidin-3-ylidene]methanolate (PubChem CID 4921335) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-pyridin-2-ylpyrrolidin-3-ylidene]methanolate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-pyridin-2-ylpyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4921335 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[2-(dimethylazaniumyl)ethyl]-4,5-dioxo-2-pyridin-2-ylpyrrolidin-3-ylidene]methanolate |
| SMILES | C[NH+](C)CCN1C(=O)C(=O)C(=C([O-])c2ccc3c(c2)OCCO3)C1c1ccccn1 |
| InChI | InChI=1S/C22H23N3O5/c1-24(2)9-10-25-19(15-5-3-4-8-23-15)18(21(27)22(25)28)20(26)14-6-7-16-17(13-14)30-12-11-29-16/h3-8,13,19,26H,9-12H2,1-2H3 |
| InChIKey | GIZRRFKBHAEGOL-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|