C26H31N3O5 — CID 4871737
2,3-dihydro-1,4-benzodioxin-6-yl-[2-[4-(dimethylamino)phenyl]-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 4871737) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[2-[4-(dimethylamino)phenyl]-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[2-[4-(dimethylamino)phenyl]-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4871737 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[2-[4-(dimethylamino)phenyl]-1-[3-(dimethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CN(C)c1ccc(C2C(=C([O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCC[NH+](C)C)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-27(2)12-5-13-29-23(17-6-9-19(10-7-17)28(3)4)22(25(31)26(29)32)24(30)18-8-11-20-21(16-18)34-15-14-33-20/h6-11,16,23,30H,5,12-15H2,1-4H3 |
| InChIKey | BAQQYSCXIVPTNJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|