C26H29BrN2O5 — CID 4977697
[2-(3-bromophenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanolate (PubChem CID 4977697) has the molecular formula C26H29BrN2O5 and a molecular weight of 529.43 g/mol. Its IUPAC name is [2-(3-bromophenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanolate.
| Compound Name | [2-(3-bromophenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanolate |
|---|---|
| PubChem CID | 4977697 |
| Molecular Formula | C26H29BrN2O5 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | [2-(3-bromophenyl)-1-[3-(diethylazaniumyl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanolate |
| SMILES | CC[NH+](CC)CCCN1C(=O)C(=O)C(=C([O-])c2ccc3c(c2)OCCO3)C1c1cccc(Br)c1 |
| InChI | InChI=1S/C26H29BrN2O5/c1-3-28(4-2)11-6-12-29-23(17-7-5-8-19(27)15-17)22(25(31)26(29)32)24(30)18-9-10-20-21(16-18)34-14-13-33-20/h5,7-10,15-16,23,30H,3-4,6,11-14H2,1-2H3 |
| InChIKey | KVYUEGJYIXCFAV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|