C26H15Cl2FN4O4 — CID 44722758
N-[(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-fluorophenyl)-1-oxophthalazin-2-yl]acetamide (PubChem CID 44722758) has the molecular formula C26H15Cl2FN4O4 and a molecular weight of 537.33 g/mol. Its IUPAC name is N-[(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-fluorophenyl)-1-oxophthalazin-2-yl]acetamide.
| Compound Name | N-[(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-fluorophenyl)-1-oxophthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 44722758 |
| Molecular Formula | C26H15Cl2FN4O4 |
| Molecular Weight | 537.33 g/mol |
| Exact Mass | 536.05 |
| IUPAC Name | N-[(E)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-fluorophenyl)-1-oxophthalazin-2-yl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccc(F)cc2)c2ccccc2c1=O)N/N=C/c1coc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C26H15Cl2FN4O4/c27-16-9-20-24(35)15(13-37-25(20)21(28)10-16)11-30-31-22(34)12-33-26(36)19-4-2-1-3-18(19)23(32-33)14-5-7-17(29)8-6-14/h1-11,13H,12H2,(H,31,34)/b30-11+ |
| InChIKey | KUGFITAFLCZWJE-KNBZMSCYSA-N |
| XLogP | 4.77 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|