C28H21ClN4O5 — CID 44723237
N-[(E)-(6-chloro-7-methyl-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-methoxyphenyl)-1-oxophthalazin-2-yl]acetamide (PubChem CID 44723237) has the molecular formula C28H21ClN4O5 and a molecular weight of 528.95 g/mol. Its IUPAC name is N-[(E)-(6-chloro-7-methyl-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-methoxyphenyl)-1-oxophthalazin-2-yl]acetamide.
| Compound Name | N-[(E)-(6-chloro-7-methyl-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-methoxyphenyl)-1-oxophthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 44723237 |
| Molecular Formula | C28H21ClN4O5 |
| Molecular Weight | 528.95 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-[(E)-(6-chloro-7-methyl-4-oxochromen-3-yl)methylideneamino]-2-[4-(4-methoxyphenyl)-1-oxophthalazin-2-yl]acetamide |
| SMILES | COc1ccc(-c2nn(CC(=O)N/N=C/c3coc4cc(C)c(Cl)cc4c3=O)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H21ClN4O5/c1-16-11-24-22(12-23(16)29)27(35)18(15-38-24)13-30-31-25(34)14-33-28(36)21-6-4-3-5-20(21)26(32-33)17-7-9-19(37-2)10-8-17/h3-13,15H,14H2,1-2H3,(H,31,34)/b30-13+ |
| InChIKey | KWUPJFJCRYIHJM-VVEOGCPPSA-N |
| XLogP | 4.29 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.95 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|