C27H20N4O4 — CID 6900125
3-(4-methoxyphenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide (PubChem CID 6900125) has the molecular formula C27H20N4O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 6900125 |
| Molecular Formula | C27H20N4O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(E)-(4-oxochromen-3-yl)methylideneamino]-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)N/N=C/c2coc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H20N4O4/c1-34-21-13-11-18(12-14-21)25-23(16-31(30-25)20-7-3-2-4-8-20)27(33)29-28-15-19-17-35-24-10-6-5-9-22(24)26(19)32/h2-17H,1H3,(H,29,33)/b28-15+ |
| InChIKey | RZERWTAYZMBOHZ-RWPZCVJISA-N |
| XLogP | 4.42 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|