C16H10Cl2N2O3S — CID 5430597
N-[(Z)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-5-methylthiophene-3-carboxamide (PubChem CID 5430597) has the molecular formula C16H10Cl2N2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is N-[(Z)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-5-methylthiophene-3-carboxamide.
| Compound Name | N-[(Z)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 5430597 |
| Molecular Formula | C16H10Cl2N2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | N-[(Z)-(6,8-dichloro-4-oxochromen-3-yl)methylideneamino]-5-methylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C\c2coc3c(Cl)cc(Cl)cc3c2=O)cs1 |
| InChI | InChI=1S/C16H10Cl2N2O3S/c1-8-2-9(7-24-8)16(22)20-19-5-10-6-23-15-12(14(10)21)3-11(17)4-13(15)18/h2-7H,1H3,(H,20,22)/b19-5- |
| InChIKey | OQGPPZFBERPVPM-IPKBDRFQSA-N |
| XLogP | 4.23 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|