C16H8Cl4N2O2 — CID 57402719
5,7-dichloro-N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-benzofuran-3-carboxamide (PubChem CID 57402719) has the molecular formula C16H8Cl4N2O2 and a molecular weight of 402.06 g/mol. Its IUPAC name is 5,7-dichloro-N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-benzofuran-3-carboxamide.
| Compound Name | 5,7-dichloro-N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 57402719 |
| Molecular Formula | C16H8Cl4N2O2 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 5,7-dichloro-N-[(E)-(2,6-dichlorophenyl)methylideneamino]-1-benzofuran-3-carboxamide |
| SMILES | O=C(N/N=C/c1c(Cl)cccc1Cl)c1coc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C16H8Cl4N2O2/c17-8-4-9-11(7-24-15(9)14(20)5-8)16(23)22-21-6-10-12(18)2-1-3-13(10)19/h1-7H,(H,22,23)/b21-6+ |
| InChIKey | DLHJQTHZDBBROT-AERZKKPOSA-N |
| XLogP | 5.81 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|