C15H16O2Se — CID 44726285
9-methyl-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 44726285) has the molecular formula C15H16O2Se and a molecular weight of 307.25 g/mol. Its IUPAC name is 9-methyl-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 9-methyl-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 44726285 |
| Molecular Formula | C15H16O2Se |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 9-methyl-2-phenylselanyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | CC1C2CC3C(OC(=O)C13)C2[Se]c1ccccc1 |
| InChI | InChI=1S/C15H16O2Se/c1-8-10-7-11-12(8)15(16)17-13(11)14(10)18-9-5-3-2-4-6-9/h2-6,8,10-14H,7H2,1H3 |
| InChIKey | ISSDJJCKCMLWTO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|