C25H28F3N5O3 — CID 44764828
benzyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate (PubChem CID 44764828) has the molecular formula C25H28F3N5O3 and a molecular weight of 503.53 g/mol. Its IUPAC name is benzyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate.
| Compound Name | benzyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 44764828 |
| Molecular Formula | C25H28F3N5O3 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | benzyl N-[6-oxo-6-[2-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]pyrrolidin-1-yl]hexyl]carbamate |
| SMILES | O=C(NCCCCCC(=O)N1CCCC1c1nnc2c(C(F)(F)F)cccn12)OCc1ccccc1 |
| InChI | InChI=1S/C25H28F3N5O3/c26-25(27,28)19-11-7-16-33-22(19)30-31-23(33)20-12-8-15-32(20)21(34)13-5-2-6-14-29-24(35)36-17-18-9-3-1-4-10-18/h1,3-4,7,9-11,16,20H,2,5-6,8,12-15,17H2,(H,29,35) |
| InChIKey | REFGXXGRNXYNAF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|